C18H24N4O — CID 133483076
5-phenyl-3-(3-pyrrolidin-1-ylazepan-1-yl)-1,2,4-oxadiazole (PubChem CID 133483076) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 5-phenyl-3-(3-pyrrolidin-1-ylazepan-1-yl)-1,2,4-oxadiazole.
| Compound Name | 5-phenyl-3-(3-pyrrolidin-1-ylazepan-1-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 133483076 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 5-phenyl-3-(3-pyrrolidin-1-ylazepan-1-yl)-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2nc(N3CCCCC(N4CCCC4)C3)no2)cc1 |
| InChI | InChI=1S/C18H24N4O/c1-2-8-15(9-3-1)17-19-18(20-23-17)22-13-5-4-10-16(14-22)21-11-6-7-12-21/h1-3,8-9,16H,4-7,10-14H2 |
| InChIKey | UVYCPGZKGUMMSU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |