C19H16BrN5O3 — CID 133483451
[4-(7-bromo-1,5-naphthyridin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone (PubChem CID 133483451) has the molecular formula C19H16BrN5O3 and a molecular weight of 442.27 g/mol. Its IUPAC name is [4-(7-bromo-1,5-naphthyridin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [4-(7-bromo-1,5-naphthyridin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 133483451 |
| Molecular Formula | C19H16BrN5O3 |
| Molecular Weight | 442.27 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | [4-(7-bromo-1,5-naphthyridin-4-yl)piperazin-1-yl]-(4-nitrophenyl)methanone |
| SMILES | O=C(c1ccc([N+](=O)[O-])cc1)N1CCN(c2ccnc3cc(Br)cnc23)CC1 |
| InChI | InChI=1S/C19H16BrN5O3/c20-14-11-16-18(22-12-14)17(5-6-21-16)23-7-9-24(10-8-23)19(26)13-1-3-15(4-2-13)25(27)28/h1-6,11-12H,7-10H2 |
| InChIKey | IVDWJFYEOREKIQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|