About 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine
7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine (PubChem CID 133483821) has the molecular formula C15H15BrN4S
and a molecular weight of 363.28 g/mol. Its IUPAC name is 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine.
Molecular Properties
| Compound Name | 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine |
| PubChem CID | 133483821 |
| Molecular Formula | C15H15BrN4S |
| Molecular Weight | 363.28 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine |
| SMILES | CCc1cnc(CN(C)c2ccnc3cc(Br)cnc23)s1 |
| InChI | InChI=1S/C15H15BrN4S/c1-3-11-8-18-14(21-11)9-20(2)13-4-5-17-12-6-10(16)7-19-15(12)13/h4-8H,3,9H2,1-2H3 |
| InChIKey | PNMBYAKZNIQDDN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine?
The IUPAC name of 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine (CID 133483821) is 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine.
What is the SMILES notation for 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine?
The canonical SMILES for 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine is CCc1cnc(CN(C)c2ccnc3cc(Br)cnc23)s1.
What is the InChIKey of 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine?
The InChIKey is PNMBYAKZNIQDDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15BrN4S/c1-3-11-8-18-14(21-11)9-20(2)13-4-5-17-12-6-10(16)7-19-15(12)13/h4-8H,3,9H2,1-2H3.
What are the key properties of 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine?
7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine has a molecular weight of 363.28 g/mol, XLogP of 4.05, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-N-[(5-ethyl-1,3-thiazol-2-yl)methyl]-N-methyl-1,5-naphthyridin-4-amine is sourced from PubChem (CID 133483821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).