About 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine
6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine (PubChem CID 133485041) has the molecular formula C15H25N3O2
and a molecular weight of 279.38 g/mol. Its IUPAC name is 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine |
| PubChem CID | 133485041 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine |
| SMILES | CCOc1cc(N(C)C2CC(C)(OC)C2(C)C)ncn1 |
| InChI | InChI=1S/C15H25N3O2/c1-7-20-13-8-12(16-10-17-13)18(5)11-9-15(4,19-6)14(11,2)3/h8,10-11H,7,9H2,1-6H3 |
| InChIKey | FBSDUFUUSGNXPA-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine?
The IUPAC name of 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine (CID 133485041) is 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine.
What is the SMILES notation for 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine?
The canonical SMILES for 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine is CCOc1cc(N(C)C2CC(C)(OC)C2(C)C)ncn1.
What is the InChIKey of 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine?
The InChIKey is FBSDUFUUSGNXPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N3O2/c1-7-20-13-8-12(16-10-17-13)18(5)11-9-15(4,19-6)14(11,2)3/h8,10-11H,7,9H2,1-6H3.
What are the key properties of 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine?
6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine has a molecular weight of 279.38 g/mol, XLogP of 2.52, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-N-(3-methoxy-2,2,3-trimethylcyclobutyl)-N-methylpyrimidin-4-amine is sourced from PubChem (CID 133485041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).