C18H26N6O — CID 133485061
2-(cyclopentylmethoxy)-6-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]pyrazine (PubChem CID 133485061) has the molecular formula C18H26N6O and a molecular weight of 342.45 g/mol. Its IUPAC name is 2-(cyclopentylmethoxy)-6-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]pyrazine.
| Compound Name | 2-(cyclopentylmethoxy)-6-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]pyrazine |
|---|---|
| PubChem CID | 133485061 |
| Molecular Formula | C18H26N6O |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 2-(cyclopentylmethoxy)-6-[4-(1-methylpyrazol-4-yl)piperazin-1-yl]pyrazine |
| SMILES | Cn1cc(N2CCN(c3cncc(OCC4CCCC4)n3)CC2)cn1 |
| InChI | InChI=1S/C18H26N6O/c1-22-13-16(10-20-22)23-6-8-24(9-7-23)17-11-19-12-18(21-17)25-14-15-4-2-3-5-15/h10-13,15H,2-9,14H2,1H3 |
| InChIKey | XQGQYNOSDPIQRO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 59.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |