About 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile
5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile (PubChem CID 133485428) has the molecular formula C14H18F3N5
and a molecular weight of 313.33 g/mol. Its IUPAC name is 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile |
| PubChem CID | 133485428 |
| Molecular Formula | C14H18F3N5 |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile |
| SMILES | N#Cc1cnc(NCCC2CCN(CC(F)(F)F)CC2)cn1 |
| InChI | InChI=1S/C14H18F3N5/c15-14(16,17)10-22-5-2-11(3-6-22)1-4-19-13-9-20-12(7-18)8-21-13/h8-9,11H,1-6,10H2,(H,19,21) |
| InChIKey | HOWHBHHTHODJNO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile?
The IUPAC name of 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile (CID 133485428) is 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile.
What is the SMILES notation for 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile?
The canonical SMILES for 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile is N#Cc1cnc(NCCC2CCN(CC(F)(F)F)CC2)cn1.
What is the InChIKey of 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile?
The InChIKey is HOWHBHHTHODJNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18F3N5/c15-14(16,17)10-22-5-2-11(3-6-22)1-4-19-13-9-20-12(7-18)8-21-13/h8-9,11H,1-6,10H2,(H,19,21).
What are the key properties of 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile?
5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile has a molecular weight of 313.33 g/mol, XLogP of 2.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-[1-(2,2,2-trifluoroethyl)piperidin-4-yl]ethylamino]pyrazine-2-carbonitrile is sourced from PubChem (CID 133485428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).