About N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine
N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine (PubChem CID 133485443) has the molecular formula C11H13F2N5O
and a molecular weight of 269.26 g/mol. Its IUPAC name is N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine |
| PubChem CID | 133485443 |
| Molecular Formula | C11H13F2N5O |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine |
| SMILES | CCOc1cc(Nc2ccn(CC(F)F)n2)ncn1 |
| InChI | InChI=1S/C11H13F2N5O/c1-2-19-11-5-10(14-7-15-11)16-9-3-4-18(17-9)6-8(12)13/h3-5,7-8H,2,6H2,1H3,(H,14,15,16,17) |
| InChIKey | AOYIIOWRCGNSCB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine?
The IUPAC name of N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine (CID 133485443) is N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine.
What is the SMILES notation for N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine?
The canonical SMILES for N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine is CCOc1cc(Nc2ccn(CC(F)F)n2)ncn1.
What is the InChIKey of N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine?
The InChIKey is AOYIIOWRCGNSCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2N5O/c1-2-19-11-5-10(14-7-15-11)16-9-3-4-18(17-9)6-8(12)13/h3-5,7-8H,2,6H2,1H3,(H,14,15,16,17).
What are the key properties of N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine?
N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine has a molecular weight of 269.26 g/mol, XLogP of 2.08, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(2,2-difluoroethyl)pyrazol-3-yl]-6-ethoxypyrimidin-4-amine is sourced from PubChem (CID 133485443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).