C17H16N4O2S — CID 133485585
N-[1-(4-methyl-3-nitrophenyl)ethyl]-3-phenyl-1,2,4-thiadiazol-5-amine (PubChem CID 133485585) has the molecular formula C17H16N4O2S and a molecular weight of 340.41 g/mol. Its IUPAC name is N-[1-(4-methyl-3-nitrophenyl)ethyl]-3-phenyl-1,2,4-thiadiazol-5-amine.
| Compound Name | N-[1-(4-methyl-3-nitrophenyl)ethyl]-3-phenyl-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 133485585 |
| Molecular Formula | C17H16N4O2S |
| Molecular Weight | 340.41 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[1-(4-methyl-3-nitrophenyl)ethyl]-3-phenyl-1,2,4-thiadiazol-5-amine |
| SMILES | Cc1ccc(C(C)Nc2nc(-c3ccccc3)ns2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N4O2S/c1-11-8-9-14(10-15(11)21(22)23)12(2)18-17-19-16(20-24-17)13-6-4-3-5-7-13/h3-10,12H,1-2H3,(H,18,19,20) |
| InChIKey | FCUGXVSISOBLFQ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|