C13H20F3N5O2 — CID 133486911
1,3-dimethyl-4-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]pyrazol-5-amine (PubChem CID 133486911) has the molecular formula C13H20F3N5O2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 1,3-dimethyl-4-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]pyrazol-5-amine.
| Compound Name | 1,3-dimethyl-4-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]pyrazol-5-amine |
|---|---|
| PubChem CID | 133486911 |
| Molecular Formula | C13H20F3N5O2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 1,3-dimethyl-4-nitro-N-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]pyrazol-5-amine |
| SMILES | Cc1nn(C)c(NCC2CCN(CC(F)(F)F)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H20F3N5O2/c1-9-11(21(22)23)12(19(2)18-9)17-7-10-3-5-20(6-4-10)8-13(14,15)16/h10,17H,3-8H2,1-2H3 |
| InChIKey | GCXKUZJYOANXLJ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|