About 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one
7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one (PubChem CID 133488185) has the molecular formula C18H10N4O3S
and a molecular weight of 362.37 g/mol. Its IUPAC name is 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one.
Molecular Properties
| Compound Name | 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one |
| PubChem CID | 133488185 |
| Molecular Formula | C18H10N4O3S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one |
| SMILES | O=c1ccc2ccc(Oc3ccc4nnc(-c5ccsc5)n4n3)cc2o1 |
| InChI | InChI=1S/C18H10N4O3S/c23-17-6-2-11-1-3-13(9-14(11)25-17)24-16-5-4-15-19-20-18(22(15)21-16)12-7-8-26-10-12/h1-10H |
| InChIKey | SPGPPNAFYUSODX-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one?
The IUPAC name of 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one (CID 133488185) is 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one.
What is the SMILES notation for 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one?
The canonical SMILES for 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one is O=c1ccc2ccc(Oc3ccc4nnc(-c5ccsc5)n4n3)cc2o1.
What is the InChIKey of 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one?
The InChIKey is SPGPPNAFYUSODX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10N4O3S/c23-17-6-2-11-1-3-13(9-14(11)25-17)24-16-5-4-15-19-20-18(22(15)21-16)12-7-8-26-10-12/h1-10H.
What are the key properties of 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one?
7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one has a molecular weight of 362.37 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3-thiophen-3-yl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)oxy]chromen-2-one is sourced from PubChem (CID 133488185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).