C14H20N6 — CID 133488550
5,6-dimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyridazin-3-amine (PubChem CID 133488550) has the molecular formula C14H20N6 and a molecular weight of 272.36 g/mol. Its IUPAC name is 5,6-dimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyridazin-3-amine.
| Compound Name | 5,6-dimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyridazin-3-amine |
|---|---|
| PubChem CID | 133488550 |
| Molecular Formula | C14H20N6 |
| Molecular Weight | 272.36 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 5,6-dimethyl-N-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylmethyl)pyridazin-3-amine |
| SMILES | Cc1cc(NCc2nnc3n2CCCCC3)nnc1C |
| InChI | InChI=1S/C14H20N6/c1-10-8-12(17-16-11(10)2)15-9-14-19-18-13-6-4-3-5-7-20(13)14/h8H,3-7,9H2,1-2H3,(H,15,17) |
| InChIKey | NUPQTYIMNPYSSU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |