About 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol
1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 133488582) has the molecular formula C14H21N5O2
and a molecular weight of 291.35 g/mol. Its IUPAC name is 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol.
Molecular Properties
| Compound Name | 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol |
| PubChem CID | 133488582 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | Cc1cc2c(NCC(O)CN3CCOCC3)nccn2n1 |
| InChI | InChI=1S/C14H21N5O2/c1-11-8-13-14(15-2-3-19(13)17-11)16-9-12(20)10-18-4-6-21-7-5-18/h2-3,8,12,20H,4-7,9-10H2,1H3,(H,15,16) |
| InChIKey | YVDOBTSNOIGGCF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol?
The IUPAC name of 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol (CID 133488582) is 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol.
What is the SMILES notation for 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol?
The canonical SMILES for 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol is Cc1cc2c(NCC(O)CN3CCOCC3)nccn2n1.
What is the InChIKey of 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol?
The InChIKey is YVDOBTSNOIGGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O2/c1-11-8-13-14(15-2-3-19(13)17-11)16-9-12(20)10-18-4-6-21-7-5-18/h2-3,8,12,20H,4-7,9-10H2,1H3,(H,15,16).
What are the key properties of 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol?
1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol has a molecular weight of 291.35 g/mol, XLogP of 0.14, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]-3-morpholin-4-ylpropan-2-ol is sourced from PubChem (CID 133488582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).