C15H16N6O — CID 133489118
[4-[[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]methyl]phenyl]urea (PubChem CID 133489118) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is [4-[[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]methyl]phenyl]urea.
| Compound Name | [4-[[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]methyl]phenyl]urea |
|---|---|
| PubChem CID | 133489118 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | [4-[[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]methyl]phenyl]urea |
| SMILES | Cc1cc2c(NCc3ccc(NC(N)=O)cc3)nccn2n1 |
| InChI | InChI=1S/C15H16N6O/c1-10-8-13-14(17-6-7-21(13)20-10)18-9-11-2-4-12(5-3-11)19-15(16)22/h2-8H,9H2,1H3,(H,17,18)(H3,16,19,22) |
| InChIKey | JINIFWPUACQOPB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 97.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |