C16H23F3N6 — CID 133489615
3-tert-butyl-6-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 133489615) has the molecular formula C16H23F3N6 and a molecular weight of 356.40 g/mol. Its IUPAC name is 3-tert-butyl-6-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-tert-butyl-6-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 133489615 |
| Molecular Formula | C16H23F3N6 |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 3-tert-butyl-6-[4-(2,2,2-trifluoroethyl)-1,4-diazepan-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CC(C)(C)c1nnc2ccc(N3CCCN(CC(F)(F)F)CC3)nn12 |
| InChI | InChI=1S/C16H23F3N6/c1-15(2,3)14-21-20-12-5-6-13(22-25(12)14)24-8-4-7-23(9-10-24)11-16(17,18)19/h5-6H,4,7-11H2,1-3H3 |
| InChIKey | DEXBYFHHRDAQAE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 49.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |