C19H22N4O — CID 133489669
2-methyl-N-[(4-phenyloxan-4-yl)methyl]pyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 133489669) has the molecular formula C19H22N4O and a molecular weight of 322.41 g/mol. Its IUPAC name is 2-methyl-N-[(4-phenyloxan-4-yl)methyl]pyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | 2-methyl-N-[(4-phenyloxan-4-yl)methyl]pyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 133489669 |
| Molecular Formula | C19H22N4O |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | 2-methyl-N-[(4-phenyloxan-4-yl)methyl]pyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Cc1cc2c(NCC3(c4ccccc4)CCOCC3)nccn2n1 |
| InChI | InChI=1S/C19H22N4O/c1-15-13-17-18(20-9-10-23(17)22-15)21-14-19(7-11-24-12-8-19)16-5-3-2-4-6-16/h2-6,9-10,13H,7-8,11-12,14H2,1H3,(H,20,21) |
| InChIKey | NBQKMFSDAHPMEJ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |