C17H15F3N4O2 — CID 133490846
3-(furan-2-yl)-3-[[2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 133490846) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is 3-(furan-2-yl)-3-[[2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-(furan-2-yl)-3-[[2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 133490846 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-(furan-2-yl)-3-[[2-pyridin-3-yl-6-(trifluoromethyl)pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | OCCC(Nc1cc(C(F)(F)F)nc(-c2cccnc2)n1)c1ccco1 |
| InChI | InChI=1S/C17H15F3N4O2/c18-17(19,20)14-9-15(22-12(5-7-25)13-4-2-8-26-13)24-16(23-14)11-3-1-6-21-10-11/h1-4,6,8-10,12,25H,5,7H2,(H,22,23,24) |
| InChIKey | IEPOXMITOWAXFC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 84.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |