C13H19N3OS — CID 133491020
4-[(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-1-ol (PubChem CID 133491020) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 4-[(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-1-ol.
| Compound Name | 4-[(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 133491020 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 4-[(2,5-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]pentan-1-ol |
| SMILES | Cc1nc(NC(C)CCCO)c2c(C)csc2n1 |
| InChI | InChI=1S/C13H19N3OS/c1-8-7-18-13-11(8)12(15-10(3)16-13)14-9(2)5-4-6-17/h7,9,17H,4-6H2,1-3H3,(H,14,15,16) |
| InChIKey | ZRDKJTFPGKBUFT-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |