C15H17F2N3O2 — CID 133491052
N-[[2-(difluoromethoxy)-5-methylphenyl]methyl]-6-ethoxypyrimidin-4-amine (PubChem CID 133491052) has the molecular formula C15H17F2N3O2 and a molecular weight of 309.32 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)-5-methylphenyl]methyl]-6-ethoxypyrimidin-4-amine.
| Compound Name | N-[[2-(difluoromethoxy)-5-methylphenyl]methyl]-6-ethoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 133491052 |
| Molecular Formula | C15H17F2N3O2 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | N-[[2-(difluoromethoxy)-5-methylphenyl]methyl]-6-ethoxypyrimidin-4-amine |
| SMILES | CCOc1cc(NCc2cc(C)ccc2OC(F)F)ncn1 |
| InChI | InChI=1S/C15H17F2N3O2/c1-3-21-14-7-13(19-9-20-14)18-8-11-6-10(2)4-5-12(11)22-15(16)17/h4-7,9,15H,3,8H2,1-2H3,(H,18,19,20) |
| InChIKey | SHJLRSAADXXQRB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |