C19H22IN5 — CID 133491971
3-tert-butyl-6-[2-(4-iodophenyl)pyrrolidin-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 133491971) has the molecular formula C19H22IN5 and a molecular weight of 447.32 g/mol. Its IUPAC name is 3-tert-butyl-6-[2-(4-iodophenyl)pyrrolidin-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-tert-butyl-6-[2-(4-iodophenyl)pyrrolidin-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 133491971 |
| Molecular Formula | C19H22IN5 |
| Molecular Weight | 447.32 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | 3-tert-butyl-6-[2-(4-iodophenyl)pyrrolidin-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CC(C)(C)c1nnc2ccc(N3CCCC3c3ccc(I)cc3)nn12 |
| InChI | InChI=1S/C19H22IN5/c1-19(2,3)18-22-21-16-10-11-17(23-25(16)18)24-12-4-5-15(24)13-6-8-14(20)9-7-13/h6-11,15H,4-5,12H2,1-3H3 |
| InChIKey | NVMWICOEHKFHPF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.32 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|