C18H28N6O2 — CID 133492404
1-methyl-4-[6-[4-(oxan-4-yl)piperazin-1-yl]pyrimidin-4-yl]piperazin-2-one (PubChem CID 133492404) has the molecular formula C18H28N6O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 1-methyl-4-[6-[4-(oxan-4-yl)piperazin-1-yl]pyrimidin-4-yl]piperazin-2-one.
| Compound Name | 1-methyl-4-[6-[4-(oxan-4-yl)piperazin-1-yl]pyrimidin-4-yl]piperazin-2-one |
|---|---|
| PubChem CID | 133492404 |
| Molecular Formula | C18H28N6O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 1-methyl-4-[6-[4-(oxan-4-yl)piperazin-1-yl]pyrimidin-4-yl]piperazin-2-one |
| SMILES | CN1CCN(c2cc(N3CCN(C4CCOCC4)CC3)ncn2)CC1=O |
| InChI | InChI=1S/C18H28N6O2/c1-21-4-5-24(13-18(21)25)17-12-16(19-14-20-17)23-8-6-22(7-9-23)15-2-10-26-11-3-15/h12,14-15H,2-11,13H2,1H3 |
| InChIKey | CKXYWOXZBKTZGH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 65.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |