C16H24N2O4 — CID 133492515
methyl 6-[(2-hydroxy-1-methylcyclohexyl)methylamino]-2-methoxypyridine-3-carboxylate (PubChem CID 133492515) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is methyl 6-[(2-hydroxy-1-methylcyclohexyl)methylamino]-2-methoxypyridine-3-carboxylate.
| Compound Name | methyl 6-[(2-hydroxy-1-methylcyclohexyl)methylamino]-2-methoxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 133492515 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | methyl 6-[(2-hydroxy-1-methylcyclohexyl)methylamino]-2-methoxypyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(NCC2(C)CCCCC2O)nc1OC |
| InChI | InChI=1S/C16H24N2O4/c1-16(9-5-4-6-12(16)19)10-17-13-8-7-11(15(20)22-3)14(18-13)21-2/h7-8,12,19H,4-6,9-10H2,1-3H3,(H,17,18) |
| InChIKey | LTQVUQHPFGATSK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |