C15H16N6 — CID 133493080
5-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 133493080) has the molecular formula C15H16N6 and a molecular weight of 280.34 g/mol. Its IUPAC name is 5-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]pyrazine-2-carbonitrile.
| Compound Name | 5-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]pyrazine-2-carbonitrile |
|---|---|
| PubChem CID | 133493080 |
| Molecular Formula | C15H16N6 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 5-[4-(4-methyl-2-pyridinyl)piperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | Cc1ccnc(N2CCN(c3cnc(C#N)cn3)CC2)c1 |
| InChI | InChI=1S/C15H16N6/c1-12-2-3-17-14(8-12)20-4-6-21(7-5-20)15-11-18-13(9-16)10-19-15/h2-3,8,10-11H,4-7H2,1H3 |
| InChIKey | CCSYOXDOZQGQPG-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |