About 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole
3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole (PubChem CID 133494087) has the molecular formula C15H26N4OS
and a molecular weight of 310.47 g/mol. Its IUPAC name is 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole |
| PubChem CID | 133494087 |
| Molecular Formula | C15H26N4OS |
| Molecular Weight | 310.47 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole |
| SMILES | CC(C)(C)c1nsc(N2CCN(C3CCOCC3)CC2)n1 |
| InChI | InChI=1S/C15H26N4OS/c1-15(2,3)13-16-14(21-17-13)19-8-6-18(7-9-19)12-4-10-20-11-5-12/h12H,4-11H2,1-3H3 |
| InChIKey | KHJKESRRVJYIFN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole?
The IUPAC name of 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole (CID 133494087) is 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole.
What is the SMILES notation for 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole?
The canonical SMILES for 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole is CC(C)(C)c1nsc(N2CCN(C3CCOCC3)CC2)n1.
What is the InChIKey of 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole?
The InChIKey is KHJKESRRVJYIFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N4OS/c1-15(2,3)13-16-14(21-17-13)19-8-6-18(7-9-19)12-4-10-20-11-5-12/h12H,4-11H2,1-3H3.
What are the key properties of 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole?
3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole has a molecular weight of 310.47 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-5-[4-(oxan-4-yl)piperazin-1-yl]-1,2,4-thiadiazole is sourced from PubChem (CID 133494087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).