About 4-amino-2-anilino-1,3-thiazole-5-carboxamide
4-amino-2-anilino-1,3-thiazole-5-carboxamide (PubChem CID 13349420) has the molecular formula C10H10N4OS
and a molecular weight of 234.28 g/mol. Its IUPAC name is 4-amino-2-anilino-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 4-amino-2-anilino-1,3-thiazole-5-carboxamide |
| PubChem CID | 13349420 |
| Molecular Formula | C10H10N4OS |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 4-amino-2-anilino-1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1sc(Nc2ccccc2)nc1N |
| InChI | InChI=1S/C10H10N4OS/c11-8-7(9(12)15)16-10(14-8)13-6-4-2-1-3-5-6/h1-5H,11H2,(H2,12,15)(H,13,14) |
| InChIKey | NLHYHLPSUOFMHW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-amino-2-anilino-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2-anilino-1,3-thiazole-5-carboxamide?
The IUPAC name of 4-amino-2-anilino-1,3-thiazole-5-carboxamide (CID 13349420) is 4-amino-2-anilino-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 4-amino-2-anilino-1,3-thiazole-5-carboxamide?
The canonical SMILES for 4-amino-2-anilino-1,3-thiazole-5-carboxamide is NC(=O)c1sc(Nc2ccccc2)nc1N.
What is the InChIKey of 4-amino-2-anilino-1,3-thiazole-5-carboxamide?
The InChIKey is NLHYHLPSUOFMHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N4OS/c11-8-7(9(12)15)16-10(14-8)13-6-4-2-1-3-5-6/h1-5H,11H2,(H2,12,15)(H,13,14).
What are the key properties of 4-amino-2-anilino-1,3-thiazole-5-carboxamide?
4-amino-2-anilino-1,3-thiazole-5-carboxamide has a molecular weight of 234.28 g/mol, XLogP of 1.57, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2-anilino-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 13349420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).