About 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine
3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine (PubChem CID 133494696) has the molecular formula C15H25N5S
and a molecular weight of 307.47 g/mol. Its IUPAC name is 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine |
| PubChem CID | 133494696 |
| Molecular Formula | C15H25N5S |
| Molecular Weight | 307.47 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine |
| SMILES | CC(C)c1nn(C)cc1CN(C)c1nc(C(C)(C)C)ns1 |
| InChI | InChI=1S/C15H25N5S/c1-10(2)12-11(9-20(7)17-12)8-19(6)14-16-13(18-21-14)15(3,4)5/h9-10H,8H2,1-7H3 |
| InChIKey | YRTNRHRHLXYNGR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine (CID 133494696) is 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine is CC(C)c1nn(C)cc1CN(C)c1nc(C(C)(C)C)ns1.
What is the InChIKey of 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine?
The InChIKey is YRTNRHRHLXYNGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H25N5S/c1-10(2)12-11(9-20(7)17-12)8-19(6)14-16-13(18-21-14)15(3,4)5/h9-10H,8H2,1-7H3.
What are the key properties of 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine?
3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine has a molecular weight of 307.47 g/mol, XLogP of 3.33, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-N-methyl-N-[(1-methyl-3-propan-2-ylpyrazol-4-yl)methyl]-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 133494696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).