C15H17N3O3 — CID 133495382
trans-(1S,2S)-2-[(8-nitroisoquinolin-5-yl)amino]cyclohexan-1-ol (PubChem CID 133495382) has the molecular formula C15H17N3O3 and a molecular weight of 287.32 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(8-nitroisoquinolin-5-yl)amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(8-nitroisoquinolin-5-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133495382 |
| Molecular Formula | C15H17N3O3 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | trans-(1S,2S)-2-[(8-nitroisoquinolin-5-yl)amino]cyclohexan-1-ol |
| SMILES | O=[N+]([O-])c1ccc(N[C@H]2CCCC[C@@H]2O)c2ccncc12 |
| InChI | InChI=1S/C15H17N3O3/c19-15-4-2-1-3-13(15)17-12-5-6-14(18(20)21)11-9-16-8-7-10(11)12/h5-9,13,15,17,19H,1-4H2/t13-,15-/m0/s1 |
| InChIKey | GHBUMLWMYIBJAT-ZFWWWQNUSA-N |
| XLogP | 2.86 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|