C17H12N4 — CID 133496710
2-[(2-methyl-1H-indol-5-yl)amino]benzene-1,3-dicarbonitrile (PubChem CID 133496710) has the molecular formula C17H12N4 and a molecular weight of 272.31 g/mol. Its IUPAC name is 2-[(2-methyl-1H-indol-5-yl)amino]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[(2-methyl-1H-indol-5-yl)amino]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 133496710 |
| Molecular Formula | C17H12N4 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-[(2-methyl-1H-indol-5-yl)amino]benzene-1,3-dicarbonitrile |
| SMILES | Cc1cc2cc(Nc3c(C#N)cccc3C#N)ccc2[nH]1 |
| InChI | InChI=1S/C17H12N4/c1-11-7-14-8-15(5-6-16(14)20-11)21-17-12(9-18)3-2-4-13(17)10-19/h2-8,20-21H,1H3 |
| InChIKey | NWBFUSTYLUFFJN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |