C22H24N4O3 — CID 133497066
1-benzyl-3-[[methyl-(6-nitroquinolin-2-yl)amino]methyl]pyrrolidin-3-ol (PubChem CID 133497066) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-benzyl-3-[[methyl-(6-nitroquinolin-2-yl)amino]methyl]pyrrolidin-3-ol.
| Compound Name | 1-benzyl-3-[[methyl-(6-nitroquinolin-2-yl)amino]methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 133497066 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-benzyl-3-[[methyl-(6-nitroquinolin-2-yl)amino]methyl]pyrrolidin-3-ol |
| SMILES | CN(CC1(O)CCN(Cc2ccccc2)C1)c1ccc2cc([N+](=O)[O-])ccc2n1 |
| InChI | InChI=1S/C22H24N4O3/c1-24(21-10-7-18-13-19(26(28)29)8-9-20(18)23-21)15-22(27)11-12-25(16-22)14-17-5-3-2-4-6-17/h2-10,13,27H,11-12,14-16H2,1H3 |
| InChIKey | IFUMNEVTBXBMJX-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|