About 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea
3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea (PubChem CID 13349783) has the molecular formula C23H22Cl3N2OP
and a molecular weight of 479.78 g/mol. Its IUPAC name is 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea |
| PubChem CID | 13349783 |
| Molecular Formula | C23H22Cl3N2OP |
| Molecular Weight | 479.78 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NC(=C(Cl)Cl)P(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H22Cl3N2OP/c1-28(2)23(29)27-22(21(24)25)30(26,18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17H,1-2H3,(H,27,29) |
| InChIKey | HNSJCFQVCRLUSY-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.78 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea?
The IUPAC name of 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea (CID 13349783) is 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea?
The canonical SMILES for 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea is CN(C)C(=O)NC(=C(Cl)Cl)P(Cl)(c1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea?
The InChIKey is HNSJCFQVCRLUSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22Cl3N2OP/c1-28(2)23(29)27-22(21(24)25)30(26,18-12-6-3-7-13-18,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h3-17H,1-2H3,(H,27,29).
What are the key properties of 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea?
3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea has a molecular weight of 479.78 g/mol, XLogP of 5.55, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,2-dichloro-1-[chloro(triphenyl)-lambda5-phosphanyl]ethenyl]-1,1-dimethylurea is sourced from PubChem (CID 13349783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).