About 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile
2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile (PubChem CID 133498198) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile |
| PubChem CID | 133498198 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cccc(C#N)c1N1CCCC2(C1)OCCO2 |
| InChI | InChI=1S/C15H15N3O2/c16-9-12-3-1-4-13(10-17)14(12)18-6-2-5-15(11-18)19-7-8-20-15/h1,3-4H,2,5-8,11H2 |
| InChIKey | AJQHVWIETFFDQC-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile?
The IUPAC name of 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile (CID 133498198) is 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile.
What is the SMILES notation for 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile?
The canonical SMILES for 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile is N#Cc1cccc(C#N)c1N1CCCC2(C1)OCCO2.
What is the InChIKey of 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile?
The InChIKey is AJQHVWIETFFDQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c16-9-12-3-1-4-13(10-17)14(12)18-6-2-5-15(11-18)19-7-8-20-15/h1,3-4H,2,5-8,11H2.
What are the key properties of 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile?
2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile has a molecular weight of 269.30 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-dioxa-9-azaspiro[4.5]decan-9-yl)benzene-1,3-dicarbonitrile is sourced from PubChem (CID 133498198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).