C18H17N3 — CID 133498329
2-(4-phenylbutan-2-ylamino)benzene-1,3-dicarbonitrile (PubChem CID 133498329) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is 2-(4-phenylbutan-2-ylamino)benzene-1,3-dicarbonitrile.
| Compound Name | 2-(4-phenylbutan-2-ylamino)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 133498329 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 2-(4-phenylbutan-2-ylamino)benzene-1,3-dicarbonitrile |
| SMILES | CC(CCc1ccccc1)Nc1c(C#N)cccc1C#N |
| InChI | InChI=1S/C18H17N3/c1-14(10-11-15-6-3-2-4-7-15)21-18-16(12-19)8-5-9-17(18)13-20/h2-9,14,21H,10-11H2,1H3 |
| InChIKey | VUQORNSZVGKPFW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |