About 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide
2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide (PubChem CID 13349931) has the molecular formula C7H15O5P
and a molecular weight of 210.17 g/mol. Its IUPAC name is 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide.
Molecular Properties
| Compound Name | 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide |
| PubChem CID | 13349931 |
| Molecular Formula | C7H15O5P |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide |
| SMILES | CCOC(OCC)P1(=O)OCCO1 |
| InChI | InChI=1S/C7H15O5P/c1-3-9-7(10-4-2)13(8)11-5-6-12-13/h7H,3-6H2,1-2H3 |
| InChIKey | VJQMRXUKMIUYCB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide?
The IUPAC name of 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide (CID 13349931) is 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide.
What is the SMILES notation for 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide?
The canonical SMILES for 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide is CCOC(OCC)P1(=O)OCCO1.
What is the InChIKey of 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide?
The InChIKey is VJQMRXUKMIUYCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O5P/c1-3-9-7(10-4-2)13(8)11-5-6-12-13/h7H,3-6H2,1-2H3.
What are the key properties of 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide?
2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide has a molecular weight of 210.17 g/mol, XLogP of 1.58, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethoxymethyl)-1,3,2lambda5-dioxaphospholane 2-oxide is sourced from PubChem (CID 13349931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).