C27H27N2O+ — CID 13350773
[4-[6-[4-(dimethylamino)phenyl]-4-phenylpyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium (PubChem CID 13350773) has the molecular formula C27H27N2O+ and a molecular weight of 395.53 g/mol. Its IUPAC name is [4-[6-[4-(dimethylamino)phenyl]-4-phenylpyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium.
| Compound Name | [4-[6-[4-(dimethylamino)phenyl]-4-phenylpyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 13350773 |
| Molecular Formula | C27H27N2O+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | [4-[6-[4-(dimethylamino)phenyl]-4-phenylpyran-2-ylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium |
| SMILES | CN(C)c1ccc(C2=CC(c3ccccc3)=CC(=C3C=CC(=[N+](C)C)C=C3)O2)cc1 |
| InChI | InChI=1S/C27H27N2O/c1-28(2)24-14-10-21(11-15-24)26-18-23(20-8-6-5-7-9-20)19-27(30-26)22-12-16-25(17-13-22)29(3)4/h5-19H,1-4H3/q+1 |
| InChIKey | DSNFKUJBPBXQDY-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|