About [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane
[(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane (PubChem CID 13350788) has the molecular formula C14H24S
and a molecular weight of 224.41 g/mol. Its IUPAC name is [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane.
Molecular Properties
| Compound Name | [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane |
| PubChem CID | 13350788 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane |
| SMILES | CC(C)(C)S/C=C/C=C/C1CCCCC1 |
| InChI | InChI=1S/C14H24S/c1-14(2,3)15-12-8-7-11-13-9-5-4-6-10-13/h7-8,11-13H,4-6,9-10H2,1-3H3/b11-7+,12-8+ |
| InChIKey | GYOOISWYAHKUDU-MKICQXMISA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane?
The IUPAC name of [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane (CID 13350788) is [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane.
What is the SMILES notation for [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane?
The canonical SMILES for [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane is CC(C)(C)S/C=C/C=C/C1CCCCC1.
What is the InChIKey of [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane?
The InChIKey is GYOOISWYAHKUDU-MKICQXMISA-N. The full InChI is InChI=1S/C14H24S/c1-14(2,3)15-12-8-7-11-13-9-5-4-6-10-13/h7-8,11-13H,4-6,9-10H2,1-3H3/b11-7+,12-8+.
What are the key properties of [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane?
[(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane has a molecular weight of 224.41 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(1E,3E)-4-tert-butylsulfanylbuta-1,3-dienyl]cyclohexane is sourced from PubChem (CID 13350788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).