About (3E,4E)-3,4-di(ethylidene)oxolane
(3E,4E)-3,4-di(ethylidene)oxolane (PubChem CID 13351107) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is (3E,4E)-3,4-di(ethylidene)oxolane.
Molecular Properties
| Compound Name | (3E,4E)-3,4-di(ethylidene)oxolane |
| PubChem CID | 13351107 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (3E,4E)-3,4-di(ethylidene)oxolane |
| SMILES | C/C=C1/COC/C1=C/C |
| InChI | InChI=1S/C8H12O/c1-3-7-5-9-6-8(7)4-2/h3-4H,5-6H2,1-2H3/b7-3-,8-4- |
| InChIKey | YEPAPRWCINITLC-VHOZIDCHSA-N |
| XLogP | 1.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3E,4E)-3,4-di(ethylidene)oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,4E)-3,4-di(ethylidene)oxolane?
The IUPAC name of (3E,4E)-3,4-di(ethylidene)oxolane (CID 13351107) is (3E,4E)-3,4-di(ethylidene)oxolane.
What is the SMILES notation for (3E,4E)-3,4-di(ethylidene)oxolane?
The canonical SMILES for (3E,4E)-3,4-di(ethylidene)oxolane is C/C=C1/COC/C1=C/C.
What is the InChIKey of (3E,4E)-3,4-di(ethylidene)oxolane?
The InChIKey is YEPAPRWCINITLC-VHOZIDCHSA-N. The full InChI is InChI=1S/C8H12O/c1-3-7-5-9-6-8(7)4-2/h3-4H,5-6H2,1-2H3/b7-3-,8-4-.
What are the key properties of (3E,4E)-3,4-di(ethylidene)oxolane?
(3E,4E)-3,4-di(ethylidene)oxolane has a molecular weight of 124.18 g/mol, XLogP of 1.91, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,4E)-3,4-di(ethylidene)oxolane is sourced from PubChem (CID 13351107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).