About methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate
methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate (PubChem CID 13351270) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate.
Analyze methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate?
The IUPAC name of methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate (CID 13351270) is methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate.
What is the SMILES notation for methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate?
The canonical SMILES for methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate is COC(=O)CC1CSC=C1C(C)(C)C.
What is the InChIKey of methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate?
The InChIKey is UXGHRHNOJKNQJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2S/c1-11(2,3)9-7-14-6-8(9)5-10(12)13-4/h7-8H,5-6H2,1-4H3.
What are the key properties of methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate?
methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate has a molecular weight of 214.33 g/mol, XLogP of 2.84, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4-tert-butyl-2,3-dihydrothiophen-3-yl)acetate is sourced from PubChem (CID 13351270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).