About 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone
1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone (PubChem CID 13351500) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone.
Analyze 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone?
The IUPAC name of 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone (CID 13351500) is 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone.
What is the SMILES notation for 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone?
The canonical SMILES for 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone is CC(=O)[C@H]1OC(C)(C)O[C@H]1C.
What is the InChIKey of 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone?
The InChIKey is DECGIDYVUDWJEE-NKWVEPMBSA-N. The full InChI is InChI=1S/C8H14O3/c1-5(9)7-6(2)10-8(3,4)11-7/h6-7H,1-4H3/t6-,7+/m0/s1.
What are the key properties of 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone?
1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone has a molecular weight of 158.20 g/mol, XLogP of 1.12, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4S,5S)-2,2,5-trimethyl-1,3-dioxolan-4-yl]ethanone is sourced from PubChem (CID 13351500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).