About 2-chlorocyclopropan-1-ol
2-chlorocyclopropan-1-ol (PubChem CID 13351704) has the molecular formula C3H5ClO
and a molecular weight of 92.52 g/mol. Its IUPAC name is 2-chlorocyclopropan-1-ol.
Molecular Properties
| Compound Name | 2-chlorocyclopropan-1-ol |
| PubChem CID | 13351704 |
| Molecular Formula | C3H5ClO |
| Molecular Weight | 92.52 g/mol |
| Exact Mass | 92.00 |
| IUPAC Name | 2-chlorocyclopropan-1-ol |
| SMILES | OC1CC1Cl |
| InChI | InChI=1S/C3H5ClO/c4-2-1-3(2)5/h2-3,5H,1H2 |
| InChIKey | FPRZZQZXVVNHMP-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 92.52 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-chlorocyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorocyclopropan-1-ol?
The IUPAC name of 2-chlorocyclopropan-1-ol (CID 13351704) is 2-chlorocyclopropan-1-ol.
What is the SMILES notation for 2-chlorocyclopropan-1-ol?
The canonical SMILES for 2-chlorocyclopropan-1-ol is OC1CC1Cl.
What is the InChIKey of 2-chlorocyclopropan-1-ol?
The InChIKey is FPRZZQZXVVNHMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5ClO/c4-2-1-3(2)5/h2-3,5H,1H2.
What are the key properties of 2-chlorocyclopropan-1-ol?
2-chlorocyclopropan-1-ol has a molecular weight of 92.52 g/mol, XLogP of 0.36, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorocyclopropan-1-ol is sourced from PubChem (CID 13351704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).