C11H10N2O2 — CID 13351733
6,10b-dihydro-5H-imidazo[5,1-a]isoquinoline-1,3-dione (PubChem CID 13351733) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 6,10b-dihydro-5H-imidazo[5,1-a]isoquinoline-1,3-dione.
| Compound Name | 6,10b-dihydro-5H-imidazo[5,1-a]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 13351733 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 6,10b-dihydro-5H-imidazo[5,1-a]isoquinoline-1,3-dione |
| SMILES | O=C1NC(=O)N2CCc3ccccc3C12 |
| InChI | InChI=1S/C11H10N2O2/c14-10-9-8-4-2-1-3-7(8)5-6-13(9)11(15)12-10/h1-4,9H,5-6H2,(H,12,14,15) |
| InChIKey | PJXMCOHISRBBFX-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|