C7H8N6OS — CID 13351803
2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]guanidine (PubChem CID 13351803) has the molecular formula C7H8N6OS and a molecular weight of 224.25 g/mol. Its IUPAC name is 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 13351803 |
| Molecular Formula | C7H8N6OS |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 2-[4-(3-methyl-1,2,4-oxadiazol-5-yl)-1,3-thiazol-2-yl]guanidine |
| SMILES | Cc1noc(-c2csc(N=C(N)N)n2)n1 |
| InChI | InChI=1S/C7H8N6OS/c1-3-10-5(14-13-3)4-2-15-7(11-4)12-6(8)9/h2H,1H3,(H4,8,9,11,12) |
| InChIKey | UFSIOBJRVPONGD-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 116.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|