About 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate
2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate (PubChem CID 13352259) has the molecular formula C21H22N2O6
and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate |
| PubChem CID | 13352259 |
| Molecular Formula | C21H22N2O6 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate |
| SMILES | CCCc1c2nc(C(=O)OC)cc(NC)c2cc2c(=O)cc(C(=O)OCC)oc12 |
| InChI | InChI=1S/C21H22N2O6/c1-5-7-11-18-12(14(22-3)9-15(23-18)20(25)27-4)8-13-16(24)10-17(29-19(11)13)21(26)28-6-2/h8-10H,5-7H2,1-4H3,(H,22,23) |
| InChIKey | GHFQEKWQUKNCCW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate?
The IUPAC name of 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate (CID 13352259) is 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate.
What is the SMILES notation for 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate?
The canonical SMILES for 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate is CCCc1c2nc(C(=O)OC)cc(NC)c2cc2c(=O)cc(C(=O)OCC)oc12.
What is the InChIKey of 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate?
The InChIKey is GHFQEKWQUKNCCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2O6/c1-5-7-11-18-12(14(22-3)9-15(23-18)20(25)27-4)8-13-16(24)10-17(29-19(11)13)21(26)28-6-2/h8-10H,5-7H2,1-4H3,(H,22,23).
What are the key properties of 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate?
2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate has a molecular weight of 398.42 g/mol, XLogP of 3.30, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-ethyl 8-O-methyl 6-(methylamino)-4-oxo-10-propylpyrano[3,2-g]quinoline-2,8-dicarboxylate is sourced from PubChem (CID 13352259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).