About 2-aminobutanenitrile;hydrochloride
2-aminobutanenitrile;hydrochloride (PubChem CID 13352436) has the molecular formula C4H9ClN2
and a molecular weight of 120.58 g/mol. Its IUPAC name is 2-aminobutanenitrile;hydrochloride.
Molecular Properties
| Compound Name | 2-aminobutanenitrile;hydrochloride |
| PubChem CID | 13352436 |
| Molecular Formula | C4H9ClN2 |
| Molecular Weight | 120.58 g/mol |
| Exact Mass | 120.05 |
| IUPAC Name | 2-aminobutanenitrile;hydrochloride |
| SMILES | CCC(N)C#N.Cl |
| InChI | InChI=1S/C4H8N2.ClH/c1-2-4(6)3-5;/h4H,2,6H2,1H3;1H |
| InChIKey | OJGHKZQRNGOMQR-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.58 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminobutanenitrile;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanenitrile;hydrochloride?
The IUPAC name of 2-aminobutanenitrile;hydrochloride (CID 13352436) is 2-aminobutanenitrile;hydrochloride.
What is the SMILES notation for 2-aminobutanenitrile;hydrochloride?
The canonical SMILES for 2-aminobutanenitrile;hydrochloride is CCC(N)C#N.Cl.
What is the InChIKey of 2-aminobutanenitrile;hydrochloride?
The InChIKey is OJGHKZQRNGOMQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2.ClH/c1-2-4(6)3-5;/h4H,2,6H2,1H3;1H.
What are the key properties of 2-aminobutanenitrile;hydrochloride?
2-aminobutanenitrile;hydrochloride has a molecular weight of 120.58 g/mol, XLogP of 0.67, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanenitrile;hydrochloride is sourced from PubChem (CID 13352436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).