C14H16O6 — CID 13353178
3,6,9,12-tetraoxabicyclo[12.2.2]octadeca-1(16),14,17-triene-2,13-dione (PubChem CID 13353178) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3,6,9,12-tetraoxabicyclo[12.2.2]octadeca-1(16),14,17-triene-2,13-dione.
| Compound Name | 3,6,9,12-tetraoxabicyclo[12.2.2]octadeca-1(16),14,17-triene-2,13-dione |
|---|---|
| PubChem CID | 13353178 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3,6,9,12-tetraoxabicyclo[12.2.2]octadeca-1(16),14,17-triene-2,13-dione |
| SMILES | O=C1OCCOCCOCCOC(=O)c2ccc1cc2 |
| InChI | InChI=1S/C14H16O6/c15-13-11-1-2-12(4-3-11)14(16)20-10-8-18-6-5-17-7-9-19-13/h1-4H,5-10H2 |
| InChIKey | VUNMUNUFPBEGEJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|