About 2-(2-phenylethyl)oxetane
2-(2-phenylethyl)oxetane (PubChem CID 13354102) has the molecular formula C11H14O
and a molecular weight of 162.23 g/mol. Its IUPAC name is 2-(2-phenylethyl)oxetane.
Molecular Properties
| Compound Name | 2-(2-phenylethyl)oxetane |
| PubChem CID | 13354102 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2-(2-phenylethyl)oxetane |
| SMILES | c1ccc(CCC2CCO2)cc1 |
| InChI | InChI=1S/C11H14O/c1-2-4-10(5-3-1)6-7-11-8-9-12-11/h1-5,11H,6-9H2 |
| InChIKey | GZQGNHSXRHZFTR-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2-phenylethyl)oxetane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-phenylethyl)oxetane?
The IUPAC name of 2-(2-phenylethyl)oxetane (CID 13354102) is 2-(2-phenylethyl)oxetane.
What is the SMILES notation for 2-(2-phenylethyl)oxetane?
The canonical SMILES for 2-(2-phenylethyl)oxetane is c1ccc(CCC2CCO2)cc1.
What is the InChIKey of 2-(2-phenylethyl)oxetane?
The InChIKey is GZQGNHSXRHZFTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O/c1-2-4-10(5-3-1)6-7-11-8-9-12-11/h1-5,11H,6-9H2.
What are the key properties of 2-(2-phenylethyl)oxetane?
2-(2-phenylethyl)oxetane has a molecular weight of 162.23 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-phenylethyl)oxetane is sourced from PubChem (CID 13354102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).