About dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium
dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium (PubChem CID 13354354) has the molecular formula C6H9Cl3N+
and a molecular weight of 201.50 g/mol. Its IUPAC name is dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium.
Molecular Properties
| Compound Name | dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium |
| PubChem CID | 13354354 |
| Molecular Formula | C6H9Cl3N+ |
| Molecular Weight | 201.50 g/mol |
| Exact Mass | 199.98 |
| IUPAC Name | dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium |
| SMILES | C[N+](C)=C/C=C/C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H9Cl3N/c1-10(2)5-3-4-6(7,8)9/h3-5H,1-2H3/q+1/b4-3+ |
| InChIKey | RRQMOLOMPCPUMW-ONEGZZNKSA-N |
| XLogP | 2.26 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium?
The IUPAC name of dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium (CID 13354354) is dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium.
What is the SMILES notation for dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium?
The canonical SMILES for dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium is C[N+](C)=C/C=C/C(Cl)(Cl)Cl.
What is the InChIKey of dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium?
The InChIKey is RRQMOLOMPCPUMW-ONEGZZNKSA-N. The full InChI is InChI=1S/C6H9Cl3N/c1-10(2)5-3-4-6(7,8)9/h3-5H,1-2H3/q+1/b4-3+.
What are the key properties of dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium?
dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium has a molecular weight of 201.50 g/mol, XLogP of 2.26, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-[(E)-4,4,4-trichlorobut-2-enylidene]azanium is sourced from PubChem (CID 13354354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).