C14H13Cl2NO4 — CID 13354358
2-(butylamino)-6,7-dichloro-5,8-dihydroxynaphthalene-1,4-dione (PubChem CID 13354358) has the molecular formula C14H13Cl2NO4 and a molecular weight of 330.17 g/mol. Its IUPAC name is 2-(butylamino)-6,7-dichloro-5,8-dihydroxynaphthalene-1,4-dione.
| Compound Name | 2-(butylamino)-6,7-dichloro-5,8-dihydroxynaphthalene-1,4-dione |
|---|---|
| PubChem CID | 13354358 |
| Molecular Formula | C14H13Cl2NO4 |
| Molecular Weight | 330.17 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 2-(butylamino)-6,7-dichloro-5,8-dihydroxynaphthalene-1,4-dione |
| SMILES | CCCCNC1=CC(=O)c2c(O)c(Cl)c(Cl)c(O)c2C1=O |
| InChI | InChI=1S/C14H13Cl2NO4/c1-2-3-4-17-6-5-7(18)8-9(12(6)19)14(21)11(16)10(15)13(8)20/h5,17,20-21H,2-4H2,1H3 |
| InChIKey | YPQWDGMLOXAECF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.17 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|