C11H11F5OSi — CID 13354629
trimethyl-[1-(2,3,4,5,6-pentafluorophenyl)ethenoxy]silane (PubChem CID 13354629) has the molecular formula C11H11F5OSi and a molecular weight of 282.28 g/mol. Its IUPAC name is trimethyl-[1-(2,3,4,5,6-pentafluorophenyl)ethenoxy]silane.
| Compound Name | trimethyl-[1-(2,3,4,5,6-pentafluorophenyl)ethenoxy]silane |
|---|---|
| PubChem CID | 13354629 |
| Molecular Formula | C11H11F5OSi |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | trimethyl-[1-(2,3,4,5,6-pentafluorophenyl)ethenoxy]silane |
| SMILES | C=C(O[Si](C)(C)C)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C11H11F5OSi/c1-5(17-18(2,3)4)6-7(12)9(14)11(16)10(15)8(6)13/h1H2,2-4H3 |
| InChIKey | VWUHPHHTAVCBMR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|