About [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate
[3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate (PubChem CID 13356615) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate.
Molecular Properties
| Compound Name | [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate |
| PubChem CID | 13356615 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate |
| SMILES | CC(=O)OCOCC(C)(C)COC(C)=O |
| InChI | InChI=1S/C10H18O5/c1-8(11)14-6-10(3,4)5-13-7-15-9(2)12/h5-7H2,1-4H3 |
| InChIKey | LLKLEQMXVVKPIL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate?
The IUPAC name of [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate (CID 13356615) is [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate.
What is the SMILES notation for [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate?
The canonical SMILES for [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate is CC(=O)OCOCC(C)(C)COC(C)=O.
What is the InChIKey of [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate?
The InChIKey is LLKLEQMXVVKPIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5/c1-8(11)14-6-10(3,4)5-13-7-15-9(2)12/h5-7H2,1-4H3.
What are the key properties of [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate?
[3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate has a molecular weight of 218.25 g/mol, XLogP of 1.11, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate is sourced from PubChem (CID 13356615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).