C10H18O5 — CID 13356615
[3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate (PubChem CID 13356615) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate.
| Compound Name | [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate |
|---|---|
| PubChem CID | 13356615 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | [3-(acetyloxymethoxy)-2,2-dimethylpropyl] acetate |
| SMILES | CC(=O)OCOCC(C)(C)COC(C)=O |
| InChI | InChI=1S/C10H18O5/c1-8(11)14-6-10(3,4)5-13-7-15-9(2)12/h5-7H2,1-4H3 |
| InChIKey | LLKLEQMXVVKPIL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|