C11H23NS — CID 13356759
3-butyl-2-(2-methylpropyl)-1,3-thiazolidine (PubChem CID 13356759) has the molecular formula C11H23NS and a molecular weight of 201.38 g/mol. Its IUPAC name is 3-butyl-2-(2-methylpropyl)-1,3-thiazolidine.
| Compound Name | 3-butyl-2-(2-methylpropyl)-1,3-thiazolidine |
|---|---|
| PubChem CID | 13356759 |
| Molecular Formula | C11H23NS |
| Molecular Weight | 201.38 g/mol |
| Exact Mass | 201.16 |
| IUPAC Name | 3-butyl-2-(2-methylpropyl)-1,3-thiazolidine |
| SMILES | CCCCN1CCSC1CC(C)C |
| InChI | InChI=1S/C11H23NS/c1-4-5-6-12-7-8-13-11(12)9-10(2)3/h10-11H,4-9H2,1-3H3 |
| InChIKey | IROQERDQELELSE-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |