About 3-trimethylsilyldeca-1,2-dien-4-ol
3-trimethylsilyldeca-1,2-dien-4-ol (PubChem CID 13357609) has the molecular formula C13H26OSi
and a molecular weight of 226.44 g/mol. Its IUPAC name is 3-trimethylsilyldeca-1,2-dien-4-ol.
Molecular Properties
| Compound Name | 3-trimethylsilyldeca-1,2-dien-4-ol |
| PubChem CID | 13357609 |
| Molecular Formula | C13H26OSi |
| Molecular Weight | 226.44 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | 3-trimethylsilyldeca-1,2-dien-4-ol |
| SMILES | C=C=C(C(O)CCCCCC)[Si](C)(C)C |
| InChI | InChI=1S/C13H26OSi/c1-6-8-9-10-11-12(14)13(7-2)15(3,4)5/h12,14H,2,6,8-11H2,1,3-5H3 |
| InChIKey | LYGYEADYJXTVAM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.44 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilyldeca-1,2-dien-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilyldeca-1,2-dien-4-ol?
The IUPAC name of 3-trimethylsilyldeca-1,2-dien-4-ol (CID 13357609) is 3-trimethylsilyldeca-1,2-dien-4-ol.
What is the SMILES notation for 3-trimethylsilyldeca-1,2-dien-4-ol?
The canonical SMILES for 3-trimethylsilyldeca-1,2-dien-4-ol is C=C=C(C(O)CCCCCC)[Si](C)(C)C.
What is the InChIKey of 3-trimethylsilyldeca-1,2-dien-4-ol?
The InChIKey is LYGYEADYJXTVAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OSi/c1-6-8-9-10-11-12(14)13(7-2)15(3,4)5/h12,14H,2,6,8-11H2,1,3-5H3.
What are the key properties of 3-trimethylsilyldeca-1,2-dien-4-ol?
3-trimethylsilyldeca-1,2-dien-4-ol has a molecular weight of 226.44 g/mol, XLogP of 3.91, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilyldeca-1,2-dien-4-ol is sourced from PubChem (CID 13357609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).